C13H20N6OS — CID 103329585
2-[[6-methyl-2-(propylamino)thieno[2,3-d]pyrimidin-4-yl]amino]ethylurea (PubChem CID 103329585) has the molecular formula C13H20N6OS and a molecular weight of 308.41 g/mol. Its IUPAC name is 2-[[6-methyl-2-(propylamino)thieno[2,3-d]pyrimidin-4-yl]amino]ethylurea.
| Compound Name | 2-[[6-methyl-2-(propylamino)thieno[2,3-d]pyrimidin-4-yl]amino]ethylurea |
|---|---|
| PubChem CID | 103329585 |
| Molecular Formula | C13H20N6OS |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 2-[[6-methyl-2-(propylamino)thieno[2,3-d]pyrimidin-4-yl]amino]ethylurea |
| SMILES | CCCNc1nc(NCCNC(N)=O)c2cc(C)sc2n1 |
| InChI | InChI=1S/C13H20N6OS/c1-3-4-17-13-18-10(15-5-6-16-12(14)20)9-7-8(2)21-11(9)19-13/h7H,3-6H2,1-2H3,(H3,14,16,20)(H2,15,17,18,19) |
| InChIKey | DTKCBYYHSRHJQL-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|