C13H19N5OS — CID 103325302
4-[[2-(ethylamino)-6-methylthieno[2,3-d]pyrimidin-4-yl]amino]butanamide (PubChem CID 103325302) has the molecular formula C13H19N5OS and a molecular weight of 293.40 g/mol. Its IUPAC name is 4-[[2-(ethylamino)-6-methylthieno[2,3-d]pyrimidin-4-yl]amino]butanamide.
| Compound Name | 4-[[2-(ethylamino)-6-methylthieno[2,3-d]pyrimidin-4-yl]amino]butanamide |
|---|---|
| PubChem CID | 103325302 |
| Molecular Formula | C13H19N5OS |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 4-[[2-(ethylamino)-6-methylthieno[2,3-d]pyrimidin-4-yl]amino]butanamide |
| SMILES | CCNc1nc(NCCCC(N)=O)c2cc(C)sc2n1 |
| InChI | InChI=1S/C13H19N5OS/c1-3-15-13-17-11(16-6-4-5-10(14)19)9-7-8(2)20-12(9)18-13/h7H,3-6H2,1-2H3,(H2,14,19)(H2,15,16,17,18) |
| InChIKey | POBFDIRMFYNNBM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|