About 2-hydrazinyl-6-methyl-N-pentylthieno[2,3-d]pyrimidin-4-amine
2-hydrazinyl-6-methyl-N-pentylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 103335234) has the molecular formula C12H19N5S
and a molecular weight of 265.39 g/mol. Its IUPAC name is 2-hydrazinyl-6-methyl-N-pentylthieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-hydrazinyl-6-methyl-N-pentylthieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 103335234 |
| Molecular Formula | C12H19N5S |
| Molecular Weight | 265.39 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 2-hydrazinyl-6-methyl-N-pentylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCCCCNc1nc(NN)nc2sc(C)cc12 |
| InChI | InChI=1S/C12H19N5S/c1-3-4-5-6-14-10-9-7-8(2)18-11(9)16-12(15-10)17-13/h7H,3-6,13H2,1-2H3,(H2,14,15,16,17) |
| InChIKey | YUTOOVYQQPEWMS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hydrazinyl-6-methyl-N-pentylthieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydrazinyl-6-methyl-N-pentylthieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of 2-hydrazinyl-6-methyl-N-pentylthieno[2,3-d]pyrimidin-4-amine (CID 103335234) is 2-hydrazinyl-6-methyl-N-pentylthieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for 2-hydrazinyl-6-methyl-N-pentylthieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for 2-hydrazinyl-6-methyl-N-pentylthieno[2,3-d]pyrimidin-4-amine is CCCCCNc1nc(NN)nc2sc(C)cc12.
What is the InChIKey of 2-hydrazinyl-6-methyl-N-pentylthieno[2,3-d]pyrimidin-4-amine?
The InChIKey is YUTOOVYQQPEWMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N5S/c1-3-4-5-6-14-10-9-7-8(2)18-11(9)16-12(15-10)17-13/h7H,3-6,13H2,1-2H3,(H2,14,15,16,17).
What are the key properties of 2-hydrazinyl-6-methyl-N-pentylthieno[2,3-d]pyrimidin-4-amine?
2-hydrazinyl-6-methyl-N-pentylthieno[2,3-d]pyrimidin-4-amine has a molecular weight of 265.39 g/mol, XLogP of 2.89, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydrazinyl-6-methyl-N-pentylthieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 103335234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).