C9H14N6O2S2 — CID 103332316
2-[(2-hydrazinyl-6-methylthieno[2,3-d]pyrimidin-4-yl)amino]ethanesulfonamide (PubChem CID 103332316) has the molecular formula C9H14N6O2S2 and a molecular weight of 302.39 g/mol. Its IUPAC name is 2-[(2-hydrazinyl-6-methylthieno[2,3-d]pyrimidin-4-yl)amino]ethanesulfonamide.
| Compound Name | 2-[(2-hydrazinyl-6-methylthieno[2,3-d]pyrimidin-4-yl)amino]ethanesulfonamide |
|---|---|
| PubChem CID | 103332316 |
| Molecular Formula | C9H14N6O2S2 |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 2-[(2-hydrazinyl-6-methylthieno[2,3-d]pyrimidin-4-yl)amino]ethanesulfonamide |
| SMILES | Cc1cc2c(NCCS(N)(=O)=O)nc(NN)nc2s1 |
| InChI | InChI=1S/C9H14N6O2S2/c1-5-4-6-7(12-2-3-19(11,16)17)13-9(15-10)14-8(6)18-5/h4H,2-3,10H2,1H3,(H2,11,16,17)(H2,12,13,14,15) |
| InChIKey | RFDBATIXZUVFRL-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|