C11H12N6OS2 — CID 114181879
4-[[(2-hydrazinyl-6-methylthieno[2,3-d]pyrimidin-4-yl)amino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 114181879) has the molecular formula C11H12N6OS2 and a molecular weight of 308.39 g/mol. Its IUPAC name is 4-[[(2-hydrazinyl-6-methylthieno[2,3-d]pyrimidin-4-yl)amino]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[(2-hydrazinyl-6-methylthieno[2,3-d]pyrimidin-4-yl)amino]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 114181879 |
| Molecular Formula | C11H12N6OS2 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 4-[[(2-hydrazinyl-6-methylthieno[2,3-d]pyrimidin-4-yl)amino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | Cc1cc2c(NCc3csc(=O)[nH]3)nc(NN)nc2s1 |
| InChI | InChI=1S/C11H12N6OS2/c1-5-2-7-8(13-3-6-4-19-11(18)14-6)15-10(17-12)16-9(7)20-5/h2,4H,3,12H2,1H3,(H,14,18)(H2,13,15,16,17) |
| InChIKey | BEUAGZQXTORUGS-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|