C10H16N6O2S2 — CID 103332314
N-[2-[(2-hydrazinyl-6-methylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]methanesulfonamide (PubChem CID 103332314) has the molecular formula C10H16N6O2S2 and a molecular weight of 316.41 g/mol. Its IUPAC name is N-[2-[(2-hydrazinyl-6-methylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[(2-hydrazinyl-6-methylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 103332314 |
| Molecular Formula | C10H16N6O2S2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | N-[2-[(2-hydrazinyl-6-methylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]methanesulfonamide |
| SMILES | Cc1cc2c(NCCNS(C)(=O)=O)nc(NN)nc2s1 |
| InChI | InChI=1S/C10H16N6O2S2/c1-6-5-7-8(12-3-4-13-20(2,17)18)14-10(16-11)15-9(7)19-6/h5,13H,3-4,11H2,1-2H3,(H2,12,14,15,16) |
| InChIKey | MRACFWHYIDCKGJ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|