C13H22N6OS — CID 103333491
N-(2-hydrazinyl-6-methylthieno[2,3-d]pyrimidin-4-yl)-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine (PubChem CID 103333491) has the molecular formula C13H22N6OS and a molecular weight of 310.43 g/mol. Its IUPAC name is N-(2-hydrazinyl-6-methylthieno[2,3-d]pyrimidin-4-yl)-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine.
| Compound Name | N-(2-hydrazinyl-6-methylthieno[2,3-d]pyrimidin-4-yl)-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 103333491 |
| Molecular Formula | C13H22N6OS |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | N-(2-hydrazinyl-6-methylthieno[2,3-d]pyrimidin-4-yl)-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine |
| SMILES | COCCN(C)CCNc1nc(NN)nc2sc(C)cc12 |
| InChI | InChI=1S/C13H22N6OS/c1-9-8-10-11(15-4-5-19(2)6-7-20-3)16-13(18-14)17-12(10)21-9/h8H,4-7,14H2,1-3H3,(H2,15,16,17,18) |
| InChIKey | LKDIBVLSLAZWPC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|