C13H21N5O2S — CID 103332567
2-hydrazinyl-N,N-bis(2-methoxyethyl)-6-methylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 103332567) has the molecular formula C13H21N5O2S and a molecular weight of 311.41 g/mol. Its IUPAC name is 2-hydrazinyl-N,N-bis(2-methoxyethyl)-6-methylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-hydrazinyl-N,N-bis(2-methoxyethyl)-6-methylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103332567 |
| Molecular Formula | C13H21N5O2S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 2-hydrazinyl-N,N-bis(2-methoxyethyl)-6-methylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | COCCN(CCOC)c1nc(NN)nc2sc(C)cc12 |
| InChI | InChI=1S/C13H21N5O2S/c1-9-8-10-11(15-13(17-14)16-12(10)21-9)18(4-6-19-2)5-7-20-3/h8H,4-7,14H2,1-3H3,(H,15,16,17) |
| InChIKey | AWOMALRVLJIEDD-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 85.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|