C11H17N5O2S2 — CID 103334584
2-hydrazinyl-N,6-dimethyl-N-(2-methylsulfonylethyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 103334584) has the molecular formula C11H17N5O2S2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 2-hydrazinyl-N,6-dimethyl-N-(2-methylsulfonylethyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-hydrazinyl-N,6-dimethyl-N-(2-methylsulfonylethyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103334584 |
| Molecular Formula | C11H17N5O2S2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 2-hydrazinyl-N,6-dimethyl-N-(2-methylsulfonylethyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1cc2c(N(C)CCS(C)(=O)=O)nc(NN)nc2s1 |
| InChI | InChI=1S/C11H17N5O2S2/c1-7-6-8-9(16(2)4-5-20(3,17)18)13-11(15-12)14-10(8)19-7/h6H,4-5,12H2,1-3H3,(H,13,14,15) |
| InChIKey | MEQZONYECYFLNF-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|