C11H17N5S — CID 103335021
2-hydrazinyl-N,6-dimethyl-N-propan-2-ylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 103335021) has the molecular formula C11H17N5S and a molecular weight of 251.36 g/mol. Its IUPAC name is 2-hydrazinyl-N,6-dimethyl-N-propan-2-ylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-hydrazinyl-N,6-dimethyl-N-propan-2-ylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103335021 |
| Molecular Formula | C11H17N5S |
| Molecular Weight | 251.36 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 2-hydrazinyl-N,6-dimethyl-N-propan-2-ylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1cc2c(N(C)C(C)C)nc(NN)nc2s1 |
| InChI | InChI=1S/C11H17N5S/c1-6(2)16(4)9-8-5-7(3)17-10(8)14-11(13-9)15-12/h5-6H,12H2,1-4H3,(H,13,14,15) |
| InChIKey | UZSCDOJEMMNUQD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|