C11H16N4O2S — CID 103336311
[4-(1-methoxypropan-2-yloxy)-6-methylthieno[2,3-d]pyrimidin-2-yl]hydrazine (PubChem CID 103336311) has the molecular formula C11H16N4O2S and a molecular weight of 268.34 g/mol. Its IUPAC name is [4-(1-methoxypropan-2-yloxy)-6-methylthieno[2,3-d]pyrimidin-2-yl]hydrazine.
| Compound Name | [4-(1-methoxypropan-2-yloxy)-6-methylthieno[2,3-d]pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 103336311 |
| Molecular Formula | C11H16N4O2S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | [4-(1-methoxypropan-2-yloxy)-6-methylthieno[2,3-d]pyrimidin-2-yl]hydrazine |
| SMILES | COCC(C)Oc1nc(NN)nc2sc(C)cc12 |
| InChI | InChI=1S/C11H16N4O2S/c1-6(5-16-3)17-9-8-4-7(2)18-10(8)14-11(13-9)15-12/h4,6H,5,12H2,1-3H3,(H,13,14,15) |
| InChIKey | MHFGVWBBRTZCNQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|