C10H14N4O2S2 — CID 133408802
N-[2-[(6-methylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]methanesulfonamide (PubChem CID 133408802) has the molecular formula C10H14N4O2S2 and a molecular weight of 286.38 g/mol. Its IUPAC name is N-[2-[(6-methylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[(6-methylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 133408802 |
| Molecular Formula | C10H14N4O2S2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | N-[2-[(6-methylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]methanesulfonamide |
| SMILES | Cc1cc2c(NCCNS(C)(=O)=O)ncnc2s1 |
| InChI | InChI=1S/C10H14N4O2S2/c1-7-5-8-9(12-6-13-10(8)17-7)11-3-4-14-18(2,15)16/h5-6,14H,3-4H2,1-2H3,(H,11,12,13) |
| InChIKey | GGPJFLHVUJLGRN-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|