C16H16N4OS — CID 133408754
N-[2-[(6-methylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]benzamide (PubChem CID 133408754) has the molecular formula C16H16N4OS and a molecular weight of 312.40 g/mol. Its IUPAC name is N-[2-[(6-methylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]benzamide.
| Compound Name | N-[2-[(6-methylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 133408754 |
| Molecular Formula | C16H16N4OS |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | N-[2-[(6-methylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]benzamide |
| SMILES | Cc1cc2c(NCCNC(=O)c3ccccc3)ncnc2s1 |
| InChI | InChI=1S/C16H16N4OS/c1-11-9-13-14(19-10-20-16(13)22-11)17-7-8-18-15(21)12-5-3-2-4-6-12/h2-6,9-10H,7-8H2,1H3,(H,18,21)(H,17,19,20) |
| InChIKey | ZLIBDRCLOAMZLB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|