C13H19N3OS2 — CID 103335156
3-[6-methyl-2-(propylamino)thieno[2,3-d]pyrimidin-4-yl]sulfanylpropan-1-ol (PubChem CID 103335156) has the molecular formula C13H19N3OS2 and a molecular weight of 297.45 g/mol. Its IUPAC name is 3-[6-methyl-2-(propylamino)thieno[2,3-d]pyrimidin-4-yl]sulfanylpropan-1-ol.
| Compound Name | 3-[6-methyl-2-(propylamino)thieno[2,3-d]pyrimidin-4-yl]sulfanylpropan-1-ol |
|---|---|
| PubChem CID | 103335156 |
| Molecular Formula | C13H19N3OS2 |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 3-[6-methyl-2-(propylamino)thieno[2,3-d]pyrimidin-4-yl]sulfanylpropan-1-ol |
| SMILES | CCCNc1nc(SCCCO)c2cc(C)sc2n1 |
| InChI | InChI=1S/C13H19N3OS2/c1-3-5-14-13-15-11(18-7-4-6-17)10-8-9(2)19-12(10)16-13/h8,17H,3-7H2,1-2H3,(H,14,15,16) |
| InChIKey | NRCFZWMWIQXFNG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|