C14H12ClN3S — CID 82309363
N-benzyl-4-chloro-6-methylthieno[2,3-d]pyrimidin-2-amine (PubChem CID 82309363) has the molecular formula C14H12ClN3S and a molecular weight of 289.79 g/mol. Its IUPAC name is N-benzyl-4-chloro-6-methylthieno[2,3-d]pyrimidin-2-amine.
| Compound Name | N-benzyl-4-chloro-6-methylthieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 82309363 |
| Molecular Formula | C14H12ClN3S |
| Molecular Weight | 289.79 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | N-benzyl-4-chloro-6-methylthieno[2,3-d]pyrimidin-2-amine |
| SMILES | Cc1cc2c(Cl)nc(NCc3ccccc3)nc2s1 |
| InChI | InChI=1S/C14H12ClN3S/c1-9-7-11-12(15)17-14(18-13(11)19-9)16-8-10-5-3-2-4-6-10/h2-7H,8H2,1H3,(H,16,17,18) |
| InChIKey | XAPSLYDQROUPDH-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.79 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |