C14H11ClN2S2 — CID 95528650
2-benzylsulfanyl-4-chloro-6-methylthieno[2,3-d]pyrimidine (PubChem CID 95528650) has the molecular formula C14H11ClN2S2 and a molecular weight of 306.84 g/mol. Its IUPAC name is 2-benzylsulfanyl-4-chloro-6-methylthieno[2,3-d]pyrimidine.
| Compound Name | 2-benzylsulfanyl-4-chloro-6-methylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 95528650 |
| Molecular Formula | C14H11ClN2S2 |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 2-benzylsulfanyl-4-chloro-6-methylthieno[2,3-d]pyrimidine |
| SMILES | Cc1cc2c(Cl)nc(SCc3ccccc3)nc2s1 |
| InChI | InChI=1S/C14H11ClN2S2/c1-9-7-11-12(15)16-14(17-13(11)19-9)18-8-10-5-3-2-4-6-10/h2-7H,8H2,1H3 |
| InChIKey | VGWLSVWEUHJTKL-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |