C17H16N2S — CID 750429
2-benzylsulfanyl-4,7-dimethylquinazoline (PubChem CID 750429) has the molecular formula C17H16N2S and a molecular weight of 280.40 g/mol. Its IUPAC name is 2-benzylsulfanyl-4,7-dimethylquinazoline.
| Compound Name | 2-benzylsulfanyl-4,7-dimethylquinazoline |
|---|---|
| PubChem CID | 750429 |
| Molecular Formula | C17H16N2S |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 2-benzylsulfanyl-4,7-dimethylquinazoline |
| SMILES | Cc1ccc2c(C)nc(SCc3ccccc3)nc2c1 |
| InChI | InChI=1S/C17H16N2S/c1-12-8-9-15-13(2)18-17(19-16(15)10-12)20-11-14-6-4-3-5-7-14/h3-10H,11H2,1-2H3 |
| InChIKey | CMVOYJZHLDTESU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |