C13H14N2OS — CID 14884312
2-benzylsulfanyl-4,6-dimethylpyrimidin-5-ol (PubChem CID 14884312) has the molecular formula C13H14N2OS and a molecular weight of 246.34 g/mol. Its IUPAC name is 2-benzylsulfanyl-4,6-dimethylpyrimidin-5-ol.
| Compound Name | 2-benzylsulfanyl-4,6-dimethylpyrimidin-5-ol |
|---|---|
| PubChem CID | 14884312 |
| Molecular Formula | C13H14N2OS |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 2-benzylsulfanyl-4,6-dimethylpyrimidin-5-ol |
| SMILES | Cc1nc(SCc2ccccc2)nc(C)c1O |
| InChI | InChI=1S/C13H14N2OS/c1-9-12(16)10(2)15-13(14-9)17-8-11-6-4-3-5-7-11/h3-7,16H,8H2,1-2H3 |
| InChIKey | WUMJSCQJRSKXGL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |