About 5-benzylsulfanyl-4,6-dimethyl-2-(trifluoromethyl)pyrimidine
5-benzylsulfanyl-4,6-dimethyl-2-(trifluoromethyl)pyrimidine (PubChem CID 170731377) has the molecular formula C14H13F3N2S
and a molecular weight of 298.33 g/mol. Its IUPAC name is 5-benzylsulfanyl-4,6-dimethyl-2-(trifluoromethyl)pyrimidine.
Molecular Properties
| Compound Name | 5-benzylsulfanyl-4,6-dimethyl-2-(trifluoromethyl)pyrimidine |
| PubChem CID | 170731377 |
| Molecular Formula | C14H13F3N2S |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 5-benzylsulfanyl-4,6-dimethyl-2-(trifluoromethyl)pyrimidine |
| SMILES | Cc1nc(C(F)(F)F)nc(C)c1SCc1ccccc1 |
| InChI | InChI=1S/C14H13F3N2S/c1-9-12(20-8-11-6-4-3-5-7-11)10(2)19-13(18-9)14(15,16)17/h3-7H,8H2,1-2H3 |
| InChIKey | PYOWINZTVAXMKC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-benzylsulfanyl-4,6-dimethyl-2-(trifluoromethyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzylsulfanyl-4,6-dimethyl-2-(trifluoromethyl)pyrimidine?
The IUPAC name of 5-benzylsulfanyl-4,6-dimethyl-2-(trifluoromethyl)pyrimidine (CID 170731377) is 5-benzylsulfanyl-4,6-dimethyl-2-(trifluoromethyl)pyrimidine.
What is the SMILES notation for 5-benzylsulfanyl-4,6-dimethyl-2-(trifluoromethyl)pyrimidine?
The canonical SMILES for 5-benzylsulfanyl-4,6-dimethyl-2-(trifluoromethyl)pyrimidine is Cc1nc(C(F)(F)F)nc(C)c1SCc1ccccc1.
What is the InChIKey of 5-benzylsulfanyl-4,6-dimethyl-2-(trifluoromethyl)pyrimidine?
The InChIKey is PYOWINZTVAXMKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13F3N2S/c1-9-12(20-8-11-6-4-3-5-7-11)10(2)19-13(18-9)14(15,16)17/h3-7H,8H2,1-2H3.
What are the key properties of 5-benzylsulfanyl-4,6-dimethyl-2-(trifluoromethyl)pyrimidine?
5-benzylsulfanyl-4,6-dimethyl-2-(trifluoromethyl)pyrimidine has a molecular weight of 298.33 g/mol, XLogP of 4.40, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzylsulfanyl-4,6-dimethyl-2-(trifluoromethyl)pyrimidine is sourced from PubChem (CID 170731377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).