C14H13F3N2S — CID 170731377
5-benzylsulfanyl-4,6-dimethyl-2-(trifluoromethyl)pyrimidine (PubChem CID 170731377) has the molecular formula C14H13F3N2S and a molecular weight of 298.33 g/mol. Its IUPAC name is 5-benzylsulfanyl-4,6-dimethyl-2-(trifluoromethyl)pyrimidine.
| Compound Name | 5-benzylsulfanyl-4,6-dimethyl-2-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 170731377 |
| Molecular Formula | C14H13F3N2S |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 5-benzylsulfanyl-4,6-dimethyl-2-(trifluoromethyl)pyrimidine |
| SMILES | Cc1nc(C(F)(F)F)nc(C)c1SCc1ccccc1 |
| InChI | InChI=1S/C14H13F3N2S/c1-9-12(20-8-11-6-4-3-5-7-11)10(2)19-13(18-9)14(15,16)17/h3-7H,8H2,1-2H3 |
| InChIKey | PYOWINZTVAXMKC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |