C13H13ClN2S — CID 63731221
4-benzylsulfanyl-6-chloro-2,5-dimethylpyrimidine (PubChem CID 63731221) has the molecular formula C13H13ClN2S and a molecular weight of 264.78 g/mol. Its IUPAC name is 4-benzylsulfanyl-6-chloro-2,5-dimethylpyrimidine.
| Compound Name | 4-benzylsulfanyl-6-chloro-2,5-dimethylpyrimidine |
|---|---|
| PubChem CID | 63731221 |
| Molecular Formula | C13H13ClN2S |
| Molecular Weight | 264.78 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 4-benzylsulfanyl-6-chloro-2,5-dimethylpyrimidine |
| SMILES | Cc1nc(Cl)c(C)c(SCc2ccccc2)n1 |
| InChI | InChI=1S/C13H13ClN2S/c1-9-12(14)15-10(2)16-13(9)17-8-11-6-4-3-5-7-11/h3-7H,8H2,1-2H3 |
| InChIKey | VLPURNLESPSZFY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.78 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |