C14H16F2N2S — CID 164871974
4-benzylsulfanyl-1-(2,2-difluoroethyl)-3,5-dimethylpyrazole (PubChem CID 164871974) has the molecular formula C14H16F2N2S and a molecular weight of 282.36 g/mol. Its IUPAC name is 4-benzylsulfanyl-1-(2,2-difluoroethyl)-3,5-dimethylpyrazole.
| Compound Name | 4-benzylsulfanyl-1-(2,2-difluoroethyl)-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 164871974 |
| Molecular Formula | C14H16F2N2S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 4-benzylsulfanyl-1-(2,2-difluoroethyl)-3,5-dimethylpyrazole |
| SMILES | Cc1nn(CC(F)F)c(C)c1SCc1ccccc1 |
| InChI | InChI=1S/C14H16F2N2S/c1-10-14(11(2)18(17-10)8-13(15)16)19-9-12-6-4-3-5-7-12/h3-7,13H,8-9H2,1-2H3 |
| InChIKey | JSFFGFSDYUPEGG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |