C13H14F2N2S — CID 164931938
4-benzylsulfanyl-1-(2,2-difluoroethyl)-5-methylpyrazole (PubChem CID 164931938) has the molecular formula C13H14F2N2S and a molecular weight of 268.33 g/mol. Its IUPAC name is 4-benzylsulfanyl-1-(2,2-difluoroethyl)-5-methylpyrazole.
| Compound Name | 4-benzylsulfanyl-1-(2,2-difluoroethyl)-5-methylpyrazole |
|---|---|
| PubChem CID | 164931938 |
| Molecular Formula | C13H14F2N2S |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 4-benzylsulfanyl-1-(2,2-difluoroethyl)-5-methylpyrazole |
| SMILES | Cc1c(SCc2ccccc2)cnn1CC(F)F |
| InChI | InChI=1S/C13H14F2N2S/c1-10-12(7-16-17(10)8-13(14)15)18-9-11-5-3-2-4-6-11/h2-7,13H,8-9H2,1H3 |
| InChIKey | TZGDZPABWQYMND-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |