About 4-benzylsulfanyl-1-(2,2-difluoroethyl)-5-methylpyrazole
4-benzylsulfanyl-1-(2,2-difluoroethyl)-5-methylpyrazole (PubChem CID 164931938) has the molecular formula C13H14F2N2S
and a molecular weight of 268.33 g/mol. Its IUPAC name is 4-benzylsulfanyl-1-(2,2-difluoroethyl)-5-methylpyrazole.
Molecular Properties
| Compound Name | 4-benzylsulfanyl-1-(2,2-difluoroethyl)-5-methylpyrazole |
| PubChem CID | 164931938 |
| Molecular Formula | C13H14F2N2S |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 4-benzylsulfanyl-1-(2,2-difluoroethyl)-5-methylpyrazole |
| SMILES | Cc1c(SCc2ccccc2)cnn1CC(F)F |
| InChI | InChI=1S/C13H14F2N2S/c1-10-12(7-16-17(10)8-13(14)15)18-9-11-5-3-2-4-6-11/h2-7,13H,8-9H2,1H3 |
| InChIKey | TZGDZPABWQYMND-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-benzylsulfanyl-1-(2,2-difluoroethyl)-5-methylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzylsulfanyl-1-(2,2-difluoroethyl)-5-methylpyrazole?
The IUPAC name of 4-benzylsulfanyl-1-(2,2-difluoroethyl)-5-methylpyrazole (CID 164931938) is 4-benzylsulfanyl-1-(2,2-difluoroethyl)-5-methylpyrazole.
What is the SMILES notation for 4-benzylsulfanyl-1-(2,2-difluoroethyl)-5-methylpyrazole?
The canonical SMILES for 4-benzylsulfanyl-1-(2,2-difluoroethyl)-5-methylpyrazole is Cc1c(SCc2ccccc2)cnn1CC(F)F.
What is the InChIKey of 4-benzylsulfanyl-1-(2,2-difluoroethyl)-5-methylpyrazole?
The InChIKey is TZGDZPABWQYMND-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F2N2S/c1-10-12(7-16-17(10)8-13(14)15)18-9-11-5-3-2-4-6-11/h2-7,13H,8-9H2,1H3.
What are the key properties of 4-benzylsulfanyl-1-(2,2-difluoroethyl)-5-methylpyrazole?
4-benzylsulfanyl-1-(2,2-difluoroethyl)-5-methylpyrazole has a molecular weight of 268.33 g/mol, XLogP of 3.75, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzylsulfanyl-1-(2,2-difluoroethyl)-5-methylpyrazole is sourced from PubChem (CID 164931938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).