C12H12F2N2S — CID 164931939
3-benzylsulfanyl-1-(2,2-difluoroethyl)pyrazole (PubChem CID 164931939) has the molecular formula C12H12F2N2S and a molecular weight of 254.31 g/mol. Its IUPAC name is 3-benzylsulfanyl-1-(2,2-difluoroethyl)pyrazole.
| Compound Name | 3-benzylsulfanyl-1-(2,2-difluoroethyl)pyrazole |
|---|---|
| PubChem CID | 164931939 |
| Molecular Formula | C12H12F2N2S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 3-benzylsulfanyl-1-(2,2-difluoroethyl)pyrazole |
| SMILES | FC(F)Cn1ccc(SCc2ccccc2)n1 |
| InChI | InChI=1S/C12H12F2N2S/c13-11(14)8-16-7-6-12(15-16)17-9-10-4-2-1-3-5-10/h1-7,11H,8-9H2 |
| InChIKey | ADPIOOMDBHLBHI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |