C10H11N3S — CID 56612261
1-benzylsulfanyl-3-methyl-1,2,4-triazole (PubChem CID 56612261) has the molecular formula C10H11N3S and a molecular weight of 205.29 g/mol. Its IUPAC name is 1-benzylsulfanyl-3-methyl-1,2,4-triazole.
| Compound Name | 1-benzylsulfanyl-3-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 56612261 |
| Molecular Formula | C10H11N3S |
| Molecular Weight | 205.29 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 1-benzylsulfanyl-3-methyl-1,2,4-triazole |
| SMILES | Cc1ncn(SCc2ccccc2)n1 |
| InChI | InChI=1S/C10H11N3S/c1-9-11-8-13(12-9)14-7-10-5-3-2-4-6-10/h2-6,8H,7H2,1H3 |
| InChIKey | APEINIDCFOBFAK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |