About 1-benzylsulfanylpyrrole-2,5-diol
1-benzylsulfanylpyrrole-2,5-diol (PubChem CID 54176954) has the molecular formula C11H11NO2S
and a molecular weight of 221.28 g/mol. Its IUPAC name is 1-benzylsulfanylpyrrole-2,5-diol.
Molecular Properties
| Compound Name | 1-benzylsulfanylpyrrole-2,5-diol |
| PubChem CID | 54176954 |
| Molecular Formula | C11H11NO2S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 1-benzylsulfanylpyrrole-2,5-diol |
| SMILES | Oc1ccc(O)n1SCc1ccccc1 |
| InChI | InChI=1S/C11H11NO2S/c13-10-6-7-11(14)12(10)15-8-9-4-2-1-3-5-9/h1-7,13-14H,8H2 |
| InChIKey | OZBGKVAIICRORH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-benzylsulfanylpyrrole-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzylsulfanylpyrrole-2,5-diol?
The IUPAC name of 1-benzylsulfanylpyrrole-2,5-diol (CID 54176954) is 1-benzylsulfanylpyrrole-2,5-diol.
What is the SMILES notation for 1-benzylsulfanylpyrrole-2,5-diol?
The canonical SMILES for 1-benzylsulfanylpyrrole-2,5-diol is Oc1ccc(O)n1SCc1ccccc1.
What is the InChIKey of 1-benzylsulfanylpyrrole-2,5-diol?
The InChIKey is OZBGKVAIICRORH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2S/c13-10-6-7-11(14)12(10)15-8-9-4-2-1-3-5-9/h1-7,13-14H,8H2.
What are the key properties of 1-benzylsulfanylpyrrole-2,5-diol?
1-benzylsulfanylpyrrole-2,5-diol has a molecular weight of 221.28 g/mol, XLogP of 2.60, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzylsulfanylpyrrole-2,5-diol is sourced from PubChem (CID 54176954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).