C12H13NO2S — CID 121009641
1-benzylsulfanylpiperidine-2,6-dione (PubChem CID 121009641) has the molecular formula C12H13NO2S and a molecular weight of 235.31 g/mol. Its IUPAC name is 1-benzylsulfanylpiperidine-2,6-dione.
| Compound Name | 1-benzylsulfanylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 121009641 |
| Molecular Formula | C12H13NO2S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 1-benzylsulfanylpiperidine-2,6-dione |
| SMILES | O=C1CCCC(=O)N1SCc1ccccc1 |
| InChI | InChI=1S/C12H13NO2S/c14-11-7-4-8-12(15)13(11)16-9-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2 |
| InChIKey | XLSDCGGYDZVQRH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|