C15H17NO — CID 132546764
1-benzyl-3,6,7,8-tetrahydro-2H-indolizin-5-one (PubChem CID 132546764) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is 1-benzyl-3,6,7,8-tetrahydro-2H-indolizin-5-one.
| Compound Name | 1-benzyl-3,6,7,8-tetrahydro-2H-indolizin-5-one |
|---|---|
| PubChem CID | 132546764 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 1-benzyl-3,6,7,8-tetrahydro-2H-indolizin-5-one |
| SMILES | O=C1CCCC2=C(Cc3ccccc3)CCN12 |
| InChI | InChI=1S/C15H17NO/c17-15-8-4-7-14-13(9-10-16(14)15)11-12-5-2-1-3-6-12/h1-3,5-6H,4,7-11H2 |
| InChIKey | AUMRKHINWFUYFY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |