C13H19NO2 — CID 101049787
9-(3-oxobutyl)-1,2,3,6,7,8-hexahydroquinolizin-4-one (PubChem CID 101049787) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 9-(3-oxobutyl)-1,2,3,6,7,8-hexahydroquinolizin-4-one.
| Compound Name | 9-(3-oxobutyl)-1,2,3,6,7,8-hexahydroquinolizin-4-one |
|---|---|
| PubChem CID | 101049787 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 9-(3-oxobutyl)-1,2,3,6,7,8-hexahydroquinolizin-4-one |
| SMILES | CC(=O)CCC1=C2CCCC(=O)N2CCC1 |
| InChI | InChI=1S/C13H19NO2/c1-10(15)7-8-11-4-3-9-14-12(11)5-2-6-13(14)16/h2-9H2,1H3 |
| InChIKey | HKMBUTOKSUELEL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |