About 8-methyl-2,5,6,7-tetrahydro-1H-indolizin-3-one
8-methyl-2,5,6,7-tetrahydro-1H-indolizin-3-one (PubChem CID 24976920) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 8-methyl-2,5,6,7-tetrahydro-1H-indolizin-3-one.
Analyze 8-methyl-2,5,6,7-tetrahydro-1H-indolizin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-2,5,6,7-tetrahydro-1H-indolizin-3-one?
The IUPAC name of 8-methyl-2,5,6,7-tetrahydro-1H-indolizin-3-one (CID 24976920) is 8-methyl-2,5,6,7-tetrahydro-1H-indolizin-3-one.
What is the SMILES notation for 8-methyl-2,5,6,7-tetrahydro-1H-indolizin-3-one?
The canonical SMILES for 8-methyl-2,5,6,7-tetrahydro-1H-indolizin-3-one is CC1=C2CCC(=O)N2CCC1.
What is the InChIKey of 8-methyl-2,5,6,7-tetrahydro-1H-indolizin-3-one?
The InChIKey is YLXYYXOMXGPBNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-7-3-2-6-10-8(7)4-5-9(10)11/h2-6H2,1H3.
What are the key properties of 8-methyl-2,5,6,7-tetrahydro-1H-indolizin-3-one?
8-methyl-2,5,6,7-tetrahydro-1H-indolizin-3-one has a molecular weight of 151.21 g/mol, XLogP of 1.68, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-2,5,6,7-tetrahydro-1H-indolizin-3-one is sourced from PubChem (CID 24976920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).