C10H13N3O — CID 166608936
1-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-2-one (PubChem CID 166608936) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is 1-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-2-one.
| Compound Name | 1-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 166608936 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 1-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-2-one |
| SMILES | Cc1cc(C)nc(N2CCCC2=O)n1 |
| InChI | InChI=1S/C10H13N3O/c1-7-6-8(2)12-10(11-7)13-5-3-4-9(13)14/h6H,3-5H2,1-2H3 |
| InChIKey | UCRLOPCWLMBXGH-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |