C12H14ClNO3S — CID 16642641
2,6-dimethyl-4-(2-oxopyrrolidin-1-yl)benzenesulfonyl chloride (PubChem CID 16642641) has the molecular formula C12H14ClNO3S and a molecular weight of 287.77 g/mol. Its IUPAC name is 2,6-dimethyl-4-(2-oxopyrrolidin-1-yl)benzenesulfonyl chloride.
| Compound Name | 2,6-dimethyl-4-(2-oxopyrrolidin-1-yl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 16642641 |
| Molecular Formula | C12H14ClNO3S |
| Molecular Weight | 287.77 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 2,6-dimethyl-4-(2-oxopyrrolidin-1-yl)benzenesulfonyl chloride |
| SMILES | Cc1cc(N2CCCC2=O)cc(C)c1S(=O)(=O)Cl |
| InChI | InChI=1S/C12H14ClNO3S/c1-8-6-10(14-5-3-4-11(14)15)7-9(2)12(8)18(13,16)17/h6-7H,3-5H2,1-2H3 |
| InChIKey | RUYVVXLCPOVPHH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.77 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |