C21H19NO4S — CID 52769070
naphthalen-2-yl 2-methyl-4-(2-oxopyrrolidin-1-yl)benzenesulfonate (PubChem CID 52769070) has the molecular formula C21H19NO4S and a molecular weight of 381.45 g/mol. Its IUPAC name is naphthalen-2-yl 2-methyl-4-(2-oxopyrrolidin-1-yl)benzenesulfonate.
| Compound Name | naphthalen-2-yl 2-methyl-4-(2-oxopyrrolidin-1-yl)benzenesulfonate |
|---|---|
| PubChem CID | 52769070 |
| Molecular Formula | C21H19NO4S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | naphthalen-2-yl 2-methyl-4-(2-oxopyrrolidin-1-yl)benzenesulfonate |
| SMILES | Cc1cc(N2CCCC2=O)ccc1S(=O)(=O)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H19NO4S/c1-15-13-18(22-12-4-7-21(22)23)9-11-20(15)27(24,25)26-19-10-8-16-5-2-3-6-17(16)14-19/h2-3,5-6,8-11,13-14H,4,7,12H2,1H3 |
| InChIKey | RJYNPTFDOAYFKQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|