C19H19NO4S — CID 18096724
2,3-dihydro-1H-inden-5-yl 4-(2-oxopyrrolidin-1-yl)benzenesulfonate (PubChem CID 18096724) has the molecular formula C19H19NO4S and a molecular weight of 357.43 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-5-yl 4-(2-oxopyrrolidin-1-yl)benzenesulfonate.
| Compound Name | 2,3-dihydro-1H-inden-5-yl 4-(2-oxopyrrolidin-1-yl)benzenesulfonate |
|---|---|
| PubChem CID | 18096724 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 2,3-dihydro-1H-inden-5-yl 4-(2-oxopyrrolidin-1-yl)benzenesulfonate |
| SMILES | O=C1CCCN1c1ccc(S(=O)(=O)Oc2ccc3c(c2)CCC3)cc1 |
| InChI | InChI=1S/C19H19NO4S/c21-19-5-2-12-20(19)16-7-10-18(11-8-16)25(22,23)24-17-9-6-14-3-1-4-15(14)13-17/h6-11,13H,1-5,12H2 |
| InChIKey | IUSLVVKGJFRAEZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|