C16H14ClNO4S — CID 2817313
(2-chlorophenyl) 4-(2-oxopyrrolidin-1-yl)benzenesulfonate (PubChem CID 2817313) has the molecular formula C16H14ClNO4S and a molecular weight of 351.81 g/mol. Its IUPAC name is (2-chlorophenyl) 4-(2-oxopyrrolidin-1-yl)benzenesulfonate.
| Compound Name | (2-chlorophenyl) 4-(2-oxopyrrolidin-1-yl)benzenesulfonate |
|---|---|
| PubChem CID | 2817313 |
| Molecular Formula | C16H14ClNO4S |
| Molecular Weight | 351.81 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | (2-chlorophenyl) 4-(2-oxopyrrolidin-1-yl)benzenesulfonate |
| SMILES | O=C1CCCN1c1ccc(S(=O)(=O)Oc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C16H14ClNO4S/c17-14-4-1-2-5-15(14)22-23(20,21)13-9-7-12(8-10-13)18-11-3-6-16(18)19/h1-2,4-5,7-10H,3,6,11H2 |
| InChIKey | MIOADHXJSYILIX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.81 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|