C16H14BrNO4S — CID 26542603
[4-(2-oxopyrrolidin-1-yl)phenyl] 3-bromobenzenesulfonate (PubChem CID 26542603) has the molecular formula C16H14BrNO4S and a molecular weight of 396.26 g/mol. Its IUPAC name is [4-(2-oxopyrrolidin-1-yl)phenyl] 3-bromobenzenesulfonate.
| Compound Name | [4-(2-oxopyrrolidin-1-yl)phenyl] 3-bromobenzenesulfonate |
|---|---|
| PubChem CID | 26542603 |
| Molecular Formula | C16H14BrNO4S |
| Molecular Weight | 396.26 g/mol |
| Exact Mass | 394.98 |
| IUPAC Name | [4-(2-oxopyrrolidin-1-yl)phenyl] 3-bromobenzenesulfonate |
| SMILES | O=C1CCCN1c1ccc(OS(=O)(=O)c2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C16H14BrNO4S/c17-12-3-1-4-15(11-12)23(20,21)22-14-8-6-13(7-9-14)18-10-2-5-16(18)19/h1,3-4,6-9,11H,2,5,10H2 |
| InChIKey | BSPVHDULNRYMJF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.26 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|