C22H19N3O5S — CID 75478912
[4-(2-oxopyrrolidin-1-yl)phenyl] 4-(pyridine-4-carbonylamino)benzenesulfonate (PubChem CID 75478912) has the molecular formula C22H19N3O5S and a molecular weight of 437.48 g/mol. Its IUPAC name is [4-(2-oxopyrrolidin-1-yl)phenyl] 4-(pyridine-4-carbonylamino)benzenesulfonate.
| Compound Name | [4-(2-oxopyrrolidin-1-yl)phenyl] 4-(pyridine-4-carbonylamino)benzenesulfonate |
|---|---|
| PubChem CID | 75478912 |
| Molecular Formula | C22H19N3O5S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | [4-(2-oxopyrrolidin-1-yl)phenyl] 4-(pyridine-4-carbonylamino)benzenesulfonate |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Oc2ccc(N3CCCC3=O)cc2)cc1)c1ccncc1 |
| InChI | InChI=1S/C22H19N3O5S/c26-21-2-1-15-25(21)18-5-7-19(8-6-18)30-31(28,29)20-9-3-17(4-10-20)24-22(27)16-11-13-23-14-12-16/h3-14H,1-2,15H2,(H,24,27) |
| InChIKey | YNVGOSNVJZEAQW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|