C19H20N2O5S — CID 52769081
(4-acetamidophenyl) 2-methyl-4-(2-oxopyrrolidin-1-yl)benzenesulfonate (PubChem CID 52769081) has the molecular formula C19H20N2O5S and a molecular weight of 388.45 g/mol. Its IUPAC name is (4-acetamidophenyl) 2-methyl-4-(2-oxopyrrolidin-1-yl)benzenesulfonate.
| Compound Name | (4-acetamidophenyl) 2-methyl-4-(2-oxopyrrolidin-1-yl)benzenesulfonate |
|---|---|
| PubChem CID | 52769081 |
| Molecular Formula | C19H20N2O5S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | (4-acetamidophenyl) 2-methyl-4-(2-oxopyrrolidin-1-yl)benzenesulfonate |
| SMILES | CC(=O)Nc1ccc(OS(=O)(=O)c2ccc(N3CCCC3=O)cc2C)cc1 |
| InChI | InChI=1S/C19H20N2O5S/c1-13-12-16(21-11-3-4-19(21)23)7-10-18(13)27(24,25)26-17-8-5-15(6-9-17)20-14(2)22/h5-10,12H,3-4,11H2,1-2H3,(H,20,22) |
| InChIKey | JIOLKTWPOWUYEI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|