C11H14N2O — CID 171622272
1-(4,5-dimethyl-3-pyridinyl)pyrrolidin-2-one (PubChem CID 171622272) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 1-(4,5-dimethyl-3-pyridinyl)pyrrolidin-2-one.
| Compound Name | 1-(4,5-dimethyl-3-pyridinyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 171622272 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 1-(4,5-dimethyl-3-pyridinyl)pyrrolidin-2-one |
| SMILES | Cc1cncc(N2CCCC2=O)c1C |
| InChI | InChI=1S/C11H14N2O/c1-8-6-12-7-10(9(8)2)13-5-3-4-11(13)14/h6-7H,3-5H2,1-2H3 |
| InChIKey | HMVWDDLGBINRLO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |