C15H19NO3 — CID 107861522
1-[(2R)-1-hydroxy-3-phenylpropan-2-yl]azepane-2,7-dione (PubChem CID 107861522) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is 1-[(2R)-1-hydroxy-3-phenylpropan-2-yl]azepane-2,7-dione.
| Compound Name | 1-[(2R)-1-hydroxy-3-phenylpropan-2-yl]azepane-2,7-dione |
|---|---|
| PubChem CID | 107861522 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 1-[(2R)-1-hydroxy-3-phenylpropan-2-yl]azepane-2,7-dione |
| SMILES | O=C1CCCCC(=O)N1[C@@H](CO)Cc1ccccc1 |
| InChI | InChI=1S/C15H19NO3/c17-11-13(10-12-6-2-1-3-7-12)16-14(18)8-4-5-9-15(16)19/h1-3,6-7,13,17H,4-5,8-11H2/t13-/m1/s1 |
| InChIKey | MGQDNKUPRIPZGA-CYBMUJFWSA-N |
| XLogP | 1.52 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|