C13H17NO2 — CID 107861552
1-[(2R)-1-hydroxy-3-phenylpropan-2-yl]pyrrolidin-2-one (PubChem CID 107861552) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 1-[(2R)-1-hydroxy-3-phenylpropan-2-yl]pyrrolidin-2-one.
| Compound Name | 1-[(2R)-1-hydroxy-3-phenylpropan-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 107861552 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 1-[(2R)-1-hydroxy-3-phenylpropan-2-yl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1[C@@H](CO)Cc1ccccc1 |
| InChI | InChI=1S/C13H17NO2/c15-10-12(14-8-4-7-13(14)16)9-11-5-2-1-3-6-11/h1-3,5-6,12,15H,4,7-10H2/t12-/m1/s1 |
| InChIKey | YJUIGYXJTZWGCV-GFCCVEGCSA-N |
| XLogP | 1.21 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |