C13H19NO3S — CID 114010346
(2S)-2-(1,1-dioxothiazinan-2-yl)-3-phenylpropan-1-ol (PubChem CID 114010346) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is (2S)-2-(1,1-dioxothiazinan-2-yl)-3-phenylpropan-1-ol.
| Compound Name | (2S)-2-(1,1-dioxothiazinan-2-yl)-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 114010346 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | (2S)-2-(1,1-dioxothiazinan-2-yl)-3-phenylpropan-1-ol |
| SMILES | O=S1(=O)CCCCN1[C@H](CO)Cc1ccccc1 |
| InChI | InChI=1S/C13H19NO3S/c15-11-13(10-12-6-2-1-3-7-12)14-8-4-5-9-18(14,16)17/h1-3,6-7,13,15H,4-5,8-11H2/t13-/m0/s1 |
| InChIKey | XRHJGBXSXXKXKY-ZDUSSCGKSA-N |
| XLogP | 1.02 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |