2-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-phenylacetic acid

C11H13NO4S — CID 24688909

IUPAC2-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-phenylacetic acid
SMILESO=C(O)C(c1ccccc1)N1CCCS1(=O)=O
InChIInChI=1S/C11H13NO4S/c13-11(14)10(9-5-2-1-3-6-9)12-7-4-8-17(12,15)16/h1-3,5-6,10H,4,7-8H2,(H,13,14)
InChIKeyLMYIULWNKUWFSE-UHFFFAOYSA-N
MW255.29 g/mol
LogP0.85
Rot. Bonds3

About 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-phenylacetic acid

2-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-phenylacetic acid (PubChem CID 24688909) has the molecular formula C11H13NO4S and a molecular weight of 255.29 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-phenylacetic acid.

Molecular Properties

Compound Name2-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-phenylacetic acid
PubChem CID24688909
Molecular FormulaC11H13NO4S
Molecular Weight255.29 g/mol
Exact Mass255.06
IUPAC Name2-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-phenylacetic acid
SMILESO=C(O)C(c1ccccc1)N1CCCS1(=O)=O
InChIInChI=1S/C11H13NO4S/c13-11(14)10(9-5-2-1-3-6-9)12-7-4-8-17(12,15)16/h1-3,5-6,10H,4,7-8H2,(H,13,14)
InChIKeyLMYIULWNKUWFSE-UHFFFAOYSA-N
XLogP0.85
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.29
LogP ≤ 50.85
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-phenylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-phenylacetic acid?
The IUPAC name of 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-phenylacetic acid (CID 24688909) is 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-phenylacetic acid.
What is the SMILES notation for 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-phenylacetic acid?
The canonical SMILES for 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-phenylacetic acid is O=C(O)C(c1ccccc1)N1CCCS1(=O)=O.
What is the InChIKey of 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-phenylacetic acid?
The InChIKey is LMYIULWNKUWFSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO4S/c13-11(14)10(9-5-2-1-3-6-9)12-7-4-8-17(12,15)16/h1-3,5-6,10H,4,7-8H2,(H,13,14).
What are the key properties of 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-phenylacetic acid?
2-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-phenylacetic acid has a molecular weight of 255.29 g/mol, XLogP of 0.85, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-phenylacetic acid is sourced from PubChem (CID 24688909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).