C11H13NO4S — CID 101164706
methyl 2-(1,1-dioxothiazetidin-2-yl)-2-phenylacetate (PubChem CID 101164706) has the molecular formula C11H13NO4S and a molecular weight of 255.30 g/mol. Its IUPAC name is methyl 2-(1,1-dioxothiazetidin-2-yl)-2-phenylacetate.
| Compound Name | methyl 2-(1,1-dioxothiazetidin-2-yl)-2-phenylacetate |
|---|---|
| PubChem CID | 101164706 |
| Molecular Formula | C11H13NO4S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | methyl 2-(1,1-dioxothiazetidin-2-yl)-2-phenylacetate |
| SMILES | COC(=O)C(c1ccccc1)N1CCS1(=O)=O |
| InChI | InChI=1S/C11H13NO4S/c1-16-11(13)10(9-5-3-2-4-6-9)12-7-8-17(12,14)15/h2-6,10H,7-8H2,1H3 |
| InChIKey | CIFXXPJPJISFKF-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |