C23H29N3O3 — CID 16666781
methyl 2-[4-[4-(butanoylamino)phenyl]piperazin-1-yl]-2-phenylacetate (PubChem CID 16666781) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is methyl 2-[4-[4-(butanoylamino)phenyl]piperazin-1-yl]-2-phenylacetate.
| Compound Name | methyl 2-[4-[4-(butanoylamino)phenyl]piperazin-1-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 16666781 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | methyl 2-[4-[4-(butanoylamino)phenyl]piperazin-1-yl]-2-phenylacetate |
| SMILES | CCCC(=O)Nc1ccc(N2CCN(C(C(=O)OC)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C23H29N3O3/c1-3-7-21(27)24-19-10-12-20(13-11-19)25-14-16-26(17-15-25)22(23(28)29-2)18-8-5-4-6-9-18/h4-6,8-13,22H,3,7,14-17H2,1-2H3,(H,24,27) |
| InChIKey | YTCBJRASVGBQLA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|