C28H31N3O3 — CID 58870690
methyl 2-[4-[4-[(3-ethylbenzoyl)amino]phenyl]piperazin-1-yl]-2-phenylacetate (PubChem CID 58870690) has the molecular formula C28H31N3O3 and a molecular weight of 457.57 g/mol. Its IUPAC name is methyl 2-[4-[4-[(3-ethylbenzoyl)amino]phenyl]piperazin-1-yl]-2-phenylacetate.
| Compound Name | methyl 2-[4-[4-[(3-ethylbenzoyl)amino]phenyl]piperazin-1-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 58870690 |
| Molecular Formula | C28H31N3O3 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | methyl 2-[4-[4-[(3-ethylbenzoyl)amino]phenyl]piperazin-1-yl]-2-phenylacetate |
| SMILES | CCc1cccc(C(=O)Nc2ccc(N3CCN(C(C(=O)OC)c4ccccc4)CC3)cc2)c1 |
| InChI | InChI=1S/C28H31N3O3/c1-3-21-8-7-11-23(20-21)27(32)29-24-12-14-25(15-13-24)30-16-18-31(19-17-30)26(28(33)34-2)22-9-5-4-6-10-22/h4-15,20,26H,3,16-19H2,1-2H3,(H,29,32) |
| InChIKey | ONVNCUVMNSDITI-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|