C25H25N3O3 — CID 69324155
2-[4-(4-benzamidophenyl)piperazin-1-yl]-2-phenylacetic acid (PubChem CID 69324155) has the molecular formula C25H25N3O3 and a molecular weight of 415.49 g/mol. Its IUPAC name is 2-[4-(4-benzamidophenyl)piperazin-1-yl]-2-phenylacetic acid.
| Compound Name | 2-[4-(4-benzamidophenyl)piperazin-1-yl]-2-phenylacetic acid |
|---|---|
| PubChem CID | 69324155 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 2-[4-(4-benzamidophenyl)piperazin-1-yl]-2-phenylacetic acid |
| SMILES | O=C(Nc1ccc(N2CCN(C(C(=O)O)c3ccccc3)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H25N3O3/c29-24(20-9-5-2-6-10-20)26-21-11-13-22(14-12-21)27-15-17-28(18-16-27)23(25(30)31)19-7-3-1-4-8-19/h1-14,23H,15-18H2,(H,26,29)(H,30,31) |
| InChIKey | GATXGCPZDQDMDV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|