C25H24IN3O3 — CID 22499405
2-[4-[4-[(2-iodobenzoyl)amino]phenyl]piperazin-1-yl]-2-phenylacetic acid (PubChem CID 22499405) has the molecular formula C25H24IN3O3 and a molecular weight of 541.39 g/mol. Its IUPAC name is 2-[4-[4-[(2-iodobenzoyl)amino]phenyl]piperazin-1-yl]-2-phenylacetic acid.
| Compound Name | 2-[4-[4-[(2-iodobenzoyl)amino]phenyl]piperazin-1-yl]-2-phenylacetic acid |
|---|---|
| PubChem CID | 22499405 |
| Molecular Formula | C25H24IN3O3 |
| Molecular Weight | 541.39 g/mol |
| Exact Mass | 541.09 |
| IUPAC Name | 2-[4-[4-[(2-iodobenzoyl)amino]phenyl]piperazin-1-yl]-2-phenylacetic acid |
| SMILES | O=C(Nc1ccc(N2CCN(C(C(=O)O)c3ccccc3)CC2)cc1)c1ccccc1I |
| InChI | InChI=1S/C25H24IN3O3/c26-22-9-5-4-8-21(22)24(30)27-19-10-12-20(13-11-19)28-14-16-29(17-15-28)23(25(31)32)18-6-2-1-3-7-18/h1-13,23H,14-17H2,(H,27,30)(H,31,32) |
| InChIKey | YZPBFWNDOAHDPO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.39 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|