C27H29N3O3 — CID 16666631
methyl 2-[4-[4-[(2-methylbenzoyl)amino]phenyl]piperazin-1-yl]-2-phenylacetate (PubChem CID 16666631) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is methyl 2-[4-[4-[(2-methylbenzoyl)amino]phenyl]piperazin-1-yl]-2-phenylacetate.
| Compound Name | methyl 2-[4-[4-[(2-methylbenzoyl)amino]phenyl]piperazin-1-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 16666631 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | methyl 2-[4-[4-[(2-methylbenzoyl)amino]phenyl]piperazin-1-yl]-2-phenylacetate |
| SMILES | COC(=O)C(c1ccccc1)N1CCN(c2ccc(NC(=O)c3ccccc3C)cc2)CC1 |
| InChI | InChI=1S/C27H29N3O3/c1-20-8-6-7-11-24(20)26(31)28-22-12-14-23(15-13-22)29-16-18-30(19-17-29)25(27(32)33-2)21-9-4-3-5-10-21/h3-15,25H,16-19H2,1-2H3,(H,28,31) |
| InChIKey | KHEZPLHUVDITJK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|