C34H32F3N3O3 — CID 20773935
methyl 2-[4-[3-methyl-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]piperazin-1-yl]-2-phenylacetate (PubChem CID 20773935) has the molecular formula C34H32F3N3O3 and a molecular weight of 587.64 g/mol. Its IUPAC name is methyl 2-[4-[3-methyl-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]piperazin-1-yl]-2-phenylacetate.
| Compound Name | methyl 2-[4-[3-methyl-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]piperazin-1-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 20773935 |
| Molecular Formula | C34H32F3N3O3 |
| Molecular Weight | 587.64 g/mol |
| Exact Mass | 587.24 |
| IUPAC Name | methyl 2-[4-[3-methyl-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]piperazin-1-yl]-2-phenylacetate |
| SMILES | COC(=O)C(c1ccccc1)N1CCN(c2ccc(NC(=O)c3ccccc3-c3ccc(C(F)(F)F)cc3)c(C)c2)CC1 |
| InChI | InChI=1S/C34H32F3N3O3/c1-23-22-27(39-18-20-40(21-19-39)31(33(42)43-2)25-8-4-3-5-9-25)16-17-30(23)38-32(41)29-11-7-6-10-28(29)24-12-14-26(15-13-24)34(35,36)37/h3-17,22,31H,18-21H2,1-2H3,(H,38,41) |
| InChIKey | ZRPCNLSZONQNKD-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.64 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|