C38H39F3N4O4 — CID 150996120
(2S)-4-methyl-2-[[2-phenyl-2-[4-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]piperazin-1-yl]acetyl]amino]pentanoic acid (PubChem CID 150996120) has the molecular formula C38H39F3N4O4 and a molecular weight of 672.75 g/mol. Its IUPAC name is (2S)-4-methyl-2-[[2-phenyl-2-[4-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]piperazin-1-yl]acetyl]amino]pentanoic acid.
| Compound Name | (2S)-4-methyl-2-[[2-phenyl-2-[4-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]piperazin-1-yl]acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 150996120 |
| Molecular Formula | C38H39F3N4O4 |
| Molecular Weight | 672.75 g/mol |
| Exact Mass | 672.29 |
| IUPAC Name | (2S)-4-methyl-2-[[2-phenyl-2-[4-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]piperazin-1-yl]acetyl]amino]pentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)C(c1ccccc1)N1CCN(c2ccc(NC(=O)c3ccccc3-c3ccc(C(F)(F)F)cc3)cc2)CC1)C(=O)O |
| InChI | InChI=1S/C38H39F3N4O4/c1-25(2)24-33(37(48)49)43-36(47)34(27-8-4-3-5-9-27)45-22-20-44(21-23-45)30-18-16-29(17-19-30)42-35(46)32-11-7-6-10-31(32)26-12-14-28(15-13-26)38(39,40)41/h3-19,25,33-34H,20-24H2,1-2H3,(H,42,46)(H,43,47)(H,48,49)/t33-,34?/m0/s1 |
| InChIKey | LTCZNFRIRIRWNN-CDRRMRQFSA-N |
| XLogP | 7.10 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.75 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|